C23H24F3N7O2S — CID 70644159
cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-[hydroxy(1H-imidazol-2-yl)methyl]cyclopentan-1-ol (PubChem CID 70644159) has the molecular formula C23H24F3N7O2S and a molecular weight of 519.55 g/mol. Its IUPAC name is cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-[hydroxy(1H-imidazol-2-yl)methyl]cyclopentan-1-ol.
| Compound Name | cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-[hydroxy(1H-imidazol-2-yl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 70644159 |
| Molecular Formula | C23H24F3N7O2S |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | cis-(1S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-[hydroxy(1H-imidazol-2-yl)methyl]cyclopentan-1-ol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@@H]2CC(C(O)c3ncc[nH]3)[C@@H](O)C2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H24F3N7O2S/c1-11-17(21-32-14-4-2-3-5-16(14)36-21)19(33-22(30-11)29-10-23(24,25)26)31-12-8-13(15(34)9-12)18(35)20-27-6-7-28-20/h2-7,12-13,15,18,34-35H,8-10H2,1H3,(H,27,28)(H2,29,30,31,33)/t12-,13?,15+,18?/m1/s1 |
| InChIKey | VPBCFVPPWGHCNQ-QMOGDXDJSA-N |
| XLogP | 4.04 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |