C24H26F3N7O2S — CID 70644164
(1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-4-[hydroxy-(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol (PubChem CID 70644164) has the molecular formula C24H26F3N7O2S and a molecular weight of 533.58 g/mol. Its IUPAC name is (1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-4-[hydroxy-(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol.
| Compound Name | (1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-4-[hydroxy-(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 70644164 |
| Molecular Formula | C24H26F3N7O2S |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (1R,2R,4S)-2-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-4-[hydroxy-(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@@H]2C[C@H](C(O)c3nccn3C)C[C@H]2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H26F3N7O2S/c1-12-18(22-32-14-5-3-4-6-17(14)37-22)20(33-23(30-12)29-11-24(25,26)27)31-15-9-13(10-16(15)35)19(36)21-28-7-8-34(21)2/h3-8,13,15-16,19,35-36H,9-11H2,1-2H3,(H2,29,30,31,33)/t13-,15+,16+,19?/m0/s1 |
| InChIKey | VZECWDFBAGJWOE-DNCAHWDISA-N |
| XLogP | 4.05 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |