C22H24F6N6O2S2 — CID 91216605
N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methyl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 91216605) has the molecular formula C22H24F6N6O2S2 and a molecular weight of 582.60 g/mol. Its IUPAC name is N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methyl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methyl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 91216605 |
| Molecular Formula | C22H24F6N6O2S2 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methyl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | Cc1nc(NCC(F)(F)F)nc(NC2CCC(CNS(=O)(=O)CC(F)(F)F)C2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H24F6N6O2S2/c1-12-17(19-33-15-4-2-3-5-16(15)37-19)18(34-20(31-12)29-10-21(23,24)25)32-14-7-6-13(8-14)9-30-38(35,36)11-22(26,27)28/h2-5,13-14,30H,6-11H2,1H3,(H2,29,31,32,34) |
| InChIKey | DBORRPUWAZMEDR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |