C15H24O2 — CID 11871982
[(1R,2S,4aR,8aS)-2,4a,5,8a-tetramethyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] formate (PubChem CID 11871982) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is [(1R,2S,4aR,8aS)-2,4a,5,8a-tetramethyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] formate.
| Compound Name | [(1R,2S,4aR,8aS)-2,4a,5,8a-tetramethyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] formate |
|---|---|
| PubChem CID | 11871982 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [(1R,2S,4aR,8aS)-2,4a,5,8a-tetramethyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] formate |
| SMILES | CC1=CCC[C@]2(C)[C@H](OC=O)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C15H24O2/c1-11-7-9-14(3)12(2)6-5-8-15(14,4)13(11)17-10-16/h6,10-11,13H,5,7-9H2,1-4H3/t11-,13+,14+,15+/m0/s1 |
| InChIKey | DAWDTDPJINNEJM-ZGKBOVNRSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|