C29H26FN5O3 — CID 118720605
1-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]-2-(6-fluoro-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 118720605) has the molecular formula C29H26FN5O3 and a molecular weight of 511.56 g/mol. Its IUPAC name is 1-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]-2-(6-fluoro-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]-2-(6-fluoro-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 118720605 |
| Molecular Formula | C29H26FN5O3 |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 1-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]-2,3-dihydroindol-1-yl]-2-(6-fluoro-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | COc1cc2ncnc(Nc3ccc4c(c3)CCN4C(=O)Cc3c(C)[nH]c4cc(F)ccc34)c2cc1OC |
| InChI | InChI=1S/C29H26FN5O3/c1-16-21(20-6-4-18(30)11-24(20)33-16)13-28(36)35-9-8-17-10-19(5-7-25(17)35)34-29-22-12-26(37-2)27(38-3)14-23(22)31-15-32-29/h4-7,10-12,14-15,33H,8-9,13H2,1-3H3,(H,31,32,34) |
| InChIKey | NEWVPRAIGYZHJF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|