C17H19NO4 — CID 118721183
3-methylbut-2-enyl 4,8-dimethoxyquinoline-2-carboxylate (PubChem CID 118721183) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-methylbut-2-enyl 4,8-dimethoxyquinoline-2-carboxylate.
| Compound Name | 3-methylbut-2-enyl 4,8-dimethoxyquinoline-2-carboxylate |
|---|---|
| PubChem CID | 118721183 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-methylbut-2-enyl 4,8-dimethoxyquinoline-2-carboxylate |
| SMILES | COc1cc(C(=O)OCC=C(C)C)nc2c(OC)cccc12 |
| InChI | InChI=1S/C17H19NO4/c1-11(2)8-9-22-17(19)13-10-15(21-4)12-6-5-7-14(20-3)16(12)18-13/h5-8,10H,9H2,1-4H3 |
| InChIKey | QPFBNANNLDTYOT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|