C25H31FN2OS — CID 118721194
3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-2-(1-methoxyethyl)-1H-indole (PubChem CID 118721194) has the molecular formula C25H31FN2OS and a molecular weight of 426.60 g/mol. Its IUPAC name is 3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-2-(1-methoxyethyl)-1H-indole.
| Compound Name | 3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-2-(1-methoxyethyl)-1H-indole |
|---|---|
| PubChem CID | 118721194 |
| Molecular Formula | C25H31FN2OS |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-2-(1-methoxyethyl)-1H-indole |
| SMILES | COC(C)c1[nH]c2ccccc2c1C1CCN(CCCSc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H31FN2OS/c1-18(29-2)25-24(22-6-3-4-7-23(22)27-25)19-12-15-28(16-13-19)14-5-17-30-21-10-8-20(26)9-11-21/h3-4,6-11,18-19,27H,5,12-17H2,1-2H3 |
| InChIKey | KYLUBFIZIDMYKO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|