C23H27FN2OS — CID 118721193
[3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-1H-indol-2-yl]methanol (PubChem CID 118721193) has the molecular formula C23H27FN2OS and a molecular weight of 398.55 g/mol. Its IUPAC name is [3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-1H-indol-2-yl]methanol.
| Compound Name | [3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 118721193 |
| Molecular Formula | C23H27FN2OS |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [3-[1-[3-(4-fluorophenyl)sulfanylpropyl]piperidin-4-yl]-1H-indol-2-yl]methanol |
| SMILES | OCc1[nH]c2ccccc2c1C1CCN(CCCSc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H27FN2OS/c24-18-6-8-19(9-7-18)28-15-3-12-26-13-10-17(11-14-26)23-20-4-1-2-5-21(20)25-22(23)16-27/h1-2,4-9,17,25,27H,3,10-16H2 |
| InChIKey | IVMJBDLZRRUJCW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|