C16H14FNO3S2 — CID 22034361
[3-(4-fluorophenyl)sulfanyl-6-methylsulfonyl-1H-indol-2-yl]methanol (PubChem CID 22034361) has the molecular formula C16H14FNO3S2 and a molecular weight of 351.42 g/mol. Its IUPAC name is [3-(4-fluorophenyl)sulfanyl-6-methylsulfonyl-1H-indol-2-yl]methanol.
| Compound Name | [3-(4-fluorophenyl)sulfanyl-6-methylsulfonyl-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 22034361 |
| Molecular Formula | C16H14FNO3S2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [3-(4-fluorophenyl)sulfanyl-6-methylsulfonyl-1H-indol-2-yl]methanol |
| SMILES | CS(=O)(=O)c1ccc2c(Sc3ccc(F)cc3)c(CO)[nH]c2c1 |
| InChI | InChI=1S/C16H14FNO3S2/c1-23(20,21)12-6-7-13-14(8-12)18-15(9-19)16(13)22-11-4-2-10(17)3-5-11/h2-8,18-19H,9H2,1H3 |
| InChIKey | AFONTALJVCJYHK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |