C20H14F4N4O2S — CID 118721263
N-[4-(3-amino-1H-indazol-6-yl)phenyl]-2-fluoro-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 118721263) has the molecular formula C20H14F4N4O2S and a molecular weight of 450.42 g/mol. Its IUPAC name is N-[4-(3-amino-1H-indazol-6-yl)phenyl]-2-fluoro-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(3-amino-1H-indazol-6-yl)phenyl]-2-fluoro-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118721263 |
| Molecular Formula | C20H14F4N4O2S |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-[4-(3-amino-1H-indazol-6-yl)phenyl]-2-fluoro-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | Nc1n[nH]c2cc(-c3ccc(NS(=O)(=O)c4cc(C(F)(F)F)ccc4F)cc3)ccc12 |
| InChI | InChI=1S/C20H14F4N4O2S/c21-16-8-4-13(20(22,23)24)10-18(16)31(29,30)28-14-5-1-11(2-6-14)12-3-7-15-17(9-12)26-27-19(15)25/h1-10,28H,(H3,25,26,27) |
| InChIKey | NHVHSFIPSNSCID-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |