C13H29ClN4O2S — CID 118721818
2-(2-acetamidoethylsulfanyl)-N-[3-(4-aminobutylamino)propyl]acetamide;hydrochloride (PubChem CID 118721818) has the molecular formula C13H29ClN4O2S and a molecular weight of 340.92 g/mol. Its IUPAC name is 2-(2-acetamidoethylsulfanyl)-N-[3-(4-aminobutylamino)propyl]acetamide;hydrochloride.
| Compound Name | 2-(2-acetamidoethylsulfanyl)-N-[3-(4-aminobutylamino)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 118721818 |
| Molecular Formula | C13H29ClN4O2S |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-(2-acetamidoethylsulfanyl)-N-[3-(4-aminobutylamino)propyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCCSCC(=O)NCCCNCCCCN.Cl |
| InChI | InChI=1S/C13H28N4O2S.ClH/c1-12(18)16-9-10-20-11-13(19)17-8-4-7-15-6-3-2-5-14;/h15H,2-11,14H2,1H3,(H,16,18)(H,17,19);1H |
| InChIKey | FHEFOJRDVSJOEK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|