C20H29N3O — CID 118723335
3-(6-methyl-2-phenylpyrimidin-4-yl)oxy-N,N-dipropylpropan-1-amine (PubChem CID 118723335) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-(6-methyl-2-phenylpyrimidin-4-yl)oxy-N,N-dipropylpropan-1-amine.
| Compound Name | 3-(6-methyl-2-phenylpyrimidin-4-yl)oxy-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 118723335 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 3-(6-methyl-2-phenylpyrimidin-4-yl)oxy-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCOc1cc(C)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H29N3O/c1-4-12-23(13-5-2)14-9-15-24-19-16-17(3)21-20(22-19)18-10-7-6-8-11-18/h6-8,10-11,16H,4-5,9,12-15H2,1-3H3 |
| InChIKey | CVACPWRGSFXFHS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|