C23H25N3O — CID 118723352
2,4-diphenyl-6-(3-pyrrolidin-1-ylpropoxy)pyrimidine (PubChem CID 118723352) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 2,4-diphenyl-6-(3-pyrrolidin-1-ylpropoxy)pyrimidine.
| Compound Name | 2,4-diphenyl-6-(3-pyrrolidin-1-ylpropoxy)pyrimidine |
|---|---|
| PubChem CID | 118723352 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2,4-diphenyl-6-(3-pyrrolidin-1-ylpropoxy)pyrimidine |
| SMILES | c1ccc(-c2cc(OCCCN3CCCC3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-3-10-19(11-4-1)21-18-22(27-17-9-16-26-14-7-8-15-26)25-23(24-21)20-12-5-2-6-13-20/h1-6,10-13,18H,7-9,14-17H2 |
| InChIKey | ABDLPEZEFXJPFP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|