C26H20BrN3O3 — CID 118723439
(10R,15S)-13-[(4-bromophenyl)methyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 118723439) has the molecular formula C26H20BrN3O3 and a molecular weight of 502.37 g/mol. Its IUPAC name is (10R,15S)-13-[(4-bromophenyl)methyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10R,15S)-13-[(4-bromophenyl)methyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 118723439 |
| Molecular Formula | C26H20BrN3O3 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | (10R,15S)-13-[(4-bromophenyl)methyl]-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | O=C1[C@@H]2Cc3c([nH]c4ccccc34)[C@@H](c3cccc(O)c3)N2C(=O)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H20BrN3O3/c27-17-10-8-15(9-11-17)14-29-25(32)22-13-20-19-6-1-2-7-21(19)28-23(20)24(30(22)26(29)33)16-4-3-5-18(31)12-16/h1-12,22,24,28,31H,13-14H2/t22-,24+/m0/s1 |
| InChIKey | KXUSWSQJFQRRSZ-LADGPHEKSA-N |
| XLogP | 5.11 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|