C20H26N4O4S — CID 118724330
4-(benzylcarbamoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 118724330) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is 4-(benzylcarbamoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-(benzylcarbamoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 118724330 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 4-(benzylcarbamoylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCCNC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N4O4S/c21-29(27,28)18-10-8-16(9-11-18)12-14-22-19(25)7-4-13-23-20(26)24-15-17-5-2-1-3-6-17/h1-3,5-6,8-11H,4,7,12-15H2,(H,22,25)(H2,21,27,28)(H2,23,24,26) |
| InChIKey | FQRCKFLQNUDOSU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|