C25H29NO4S2 — CID 118724650
N-(2-methylpropyl)-4-(4-methylsulfonylphenyl)-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 118724650) has the molecular formula C25H29NO4S2 and a molecular weight of 471.64 g/mol. Its IUPAC name is N-(2-methylpropyl)-4-(4-methylsulfonylphenyl)-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | N-(2-methylpropyl)-4-(4-methylsulfonylphenyl)-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118724650 |
| Molecular Formula | C25H29NO4S2 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-(2-methylpropyl)-4-(4-methylsulfonylphenyl)-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | CC(C)CN(CCc1ccccc1)S(=O)(=O)c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C25H29NO4S2/c1-20(2)19-26(18-17-21-7-5-4-6-8-21)32(29,30)25-15-11-23(12-16-25)22-9-13-24(14-10-22)31(3,27)28/h4-16,20H,17-19H2,1-3H3 |
| InChIKey | CLANWEBWPUWEFS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |