C23H24N4O2 — CID 118724773
4-[[(4-phenyl-6-pyridin-4-ylpyrimidin-2-yl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 118724773) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[[(4-phenyl-6-pyridin-4-ylpyrimidin-2-yl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(4-phenyl-6-pyridin-4-ylpyrimidin-2-yl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118724773 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[[(4-phenyl-6-pyridin-4-ylpyrimidin-2-yl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNc2nc(-c3ccccc3)cc(-c3ccncc3)n2)CC1 |
| InChI | InChI=1S/C23H24N4O2/c28-22(29)19-8-6-16(7-9-19)15-25-23-26-20(17-4-2-1-3-5-17)14-21(27-23)18-10-12-24-13-11-18/h1-5,10-14,16,19H,6-9,15H2,(H,28,29)(H,25,26,27) |
| InChIKey | BWVSJNJIHSBPIO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |