C27H31NO6 — CID 118726068
N-[(10S)-15-(1-hydroxycyclopentyl)-3,4,5-trimethoxy-14-oxatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,12,15,17-heptaen-10-yl]acetamide (PubChem CID 118726068) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[(10S)-15-(1-hydroxycyclopentyl)-3,4,5-trimethoxy-14-oxatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,12,15,17-heptaen-10-yl]acetamide.
| Compound Name | N-[(10S)-15-(1-hydroxycyclopentyl)-3,4,5-trimethoxy-14-oxatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,12,15,17-heptaen-10-yl]acetamide |
|---|---|
| PubChem CID | 118726068 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[(10S)-15-(1-hydroxycyclopentyl)-3,4,5-trimethoxy-14-oxatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2,4,6,12,15,17-heptaen-10-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1cc3cc(C4(O)CCCC4)oc3cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C27H31NO6/c1-15(29)28-20-8-7-16-12-22(31-2)25(32-3)26(33-4)24(16)19-11-17-13-23(27(30)9-5-6-10-27)34-21(17)14-18(19)20/h11-14,20,30H,5-10H2,1-4H3,(H,28,29)/t20-/m0/s1 |
| InChIKey | USDLBCXINOEURV-FQEVSTJZSA-N |
| XLogP | 5.01 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |