C10H18ClN3O4 — CID 118726793
methyl (E)-4-[[(2S)-2-amino-3-(dimethylamino)-3-oxopropyl]amino]-4-oxobut-2-enoate;hydrochloride (PubChem CID 118726793) has the molecular formula C10H18ClN3O4 and a molecular weight of 279.72 g/mol. Its IUPAC name is methyl (E)-4-[[(2S)-2-amino-3-(dimethylamino)-3-oxopropyl]amino]-4-oxobut-2-enoate;hydrochloride.
| Compound Name | methyl (E)-4-[[(2S)-2-amino-3-(dimethylamino)-3-oxopropyl]amino]-4-oxobut-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 118726793 |
| Molecular Formula | C10H18ClN3O4 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | methyl (E)-4-[[(2S)-2-amino-3-(dimethylamino)-3-oxopropyl]amino]-4-oxobut-2-enoate;hydrochloride |
| SMILES | COC(=O)/C=C/C(=O)NC[C@H](N)C(=O)N(C)C.Cl |
| InChI | InChI=1S/C10H17N3O4.ClH/c1-13(2)10(16)7(11)6-12-8(14)4-5-9(15)17-3;/h4-5,7H,6,11H2,1-3H3,(H,12,14);1H/b5-4+;/t7-;/m0./s1 |
| InChIKey | KMDRGRYEUUZEHX-NPNPHVFISA-N |
| XLogP | -1.33 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|