C8H12N2O5 — CID 25245025
(2S)-2-azaniumyl-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoate (PubChem CID 25245025) has the molecular formula C8H12N2O5 and a molecular weight of 216.19 g/mol. Its IUPAC name is (2S)-2-azaniumyl-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoate.
| Compound Name | (2S)-2-azaniumyl-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 25245025 |
| Molecular Formula | C8H12N2O5 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | (2S)-2-azaniumyl-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoate |
| SMILES | COC(=O)/C=C/C(=O)NC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C8H12N2O5/c1-15-7(12)3-2-6(11)10-4-5(9)8(13)14/h2-3,5H,4,9H2,1H3,(H,10,11)(H,13,14)/b3-2+/t5-/m0/s1 |
| InChIKey | IXTGTEFAVXEHRV-HRJJCQLASA-N |
| XLogP | -3.81 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|