C7H9N2O5- — CID 46926285
(E)-4-[[(2S)-2-azaniumyl-2-carboxylatoethyl]amino]-4-oxobut-2-enoate (PubChem CID 46926285) has the molecular formula C7H9N2O5- and a molecular weight of 201.16 g/mol. Its IUPAC name is (E)-4-[[(2S)-2-azaniumyl-2-carboxylatoethyl]amino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[[(2S)-2-azaniumyl-2-carboxylatoethyl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 46926285 |
| Molecular Formula | C7H9N2O5- |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | (E)-4-[[(2S)-2-azaniumyl-2-carboxylatoethyl]amino]-4-oxobut-2-enoate |
| SMILES | [NH3+][C@@H](CNC(=O)/C=C/C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H10N2O5/c8-4(7(13)14)3-9-5(10)1-2-6(11)12/h1-2,4H,3,8H2,(H,9,10)(H,11,12)(H,13,14)/p-1/b2-1+/t4-/m0/s1 |
| InChIKey | FYPSRFSOOLJBNE-QPHDTYRISA-M |
| XLogP | -5.23 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|