C31H21BrN4O8S3 — CID 118728696
(2S)-3-(4-bromophenyl)-2-[(5Z)-5-[[4-(4-nitrophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)sulfonylpropanamide (PubChem CID 118728696) has the molecular formula C31H21BrN4O8S3 and a molecular weight of 753.63 g/mol. Its IUPAC name is (2S)-3-(4-bromophenyl)-2-[(5Z)-5-[[4-(4-nitrophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)sulfonylpropanamide.
| Compound Name | (2S)-3-(4-bromophenyl)-2-[(5Z)-5-[[4-(4-nitrophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 118728696 |
| Molecular Formula | C31H21BrN4O8S3 |
| Molecular Weight | 753.63 g/mol |
| Exact Mass | 751.97 |
| IUPAC Name | (2S)-3-(4-bromophenyl)-2-[(5Z)-5-[[4-(4-nitrophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-nitrophenyl)sulfonylpropanamide |
| SMILES | O=C(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)[C@H](Cc1ccc(Br)cc1)N1C(=O)/C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)cc2)SC1=S |
| InChI | InChI=1S/C31H21BrN4O8S3/c32-23-9-3-19(4-10-23)17-27(29(37)33-47(43,44)26-15-13-25(14-16-26)36(41)42)34-30(38)28(46-31(34)45)18-20-1-5-21(6-2-20)22-7-11-24(12-8-22)35(39)40/h1-16,18,27H,17H2,(H,33,37)/b28-18-/t27-/m0/s1 |
| InChIKey | GJNNQNGEIJNCML-ZNBSHBAVSA-N |
| XLogP | 6.25 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|