C32H22F3N3O6S3 — CID 118728692
(2S)-N-(4-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanamide (PubChem CID 118728692) has the molecular formula C32H22F3N3O6S3 and a molecular weight of 697.74 g/mol. Its IUPAC name is (2S)-N-(4-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 118728692 |
| Molecular Formula | C32H22F3N3O6S3 |
| Molecular Weight | 697.74 g/mol |
| Exact Mass | 697.06 |
| IUPAC Name | (2S)-N-(4-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-2-sulfanylidene-5-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanamide |
| SMILES | O=C(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)[C@H](Cc1ccccc1)N1C(=O)/C(=C/c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)SC1=S |
| InChI | InChI=1S/C32H22F3N3O6S3/c33-32(34,35)24-12-10-23(11-13-24)22-8-6-21(7-9-22)19-28-30(40)37(31(45)46-28)27(18-20-4-2-1-3-5-20)29(39)36-47(43,44)26-16-14-25(15-17-26)38(41)42/h1-17,19,27H,18H2,(H,36,39)/b28-19-/t27-/m0/s1 |
| InChIKey | VGUQQJLVVIMEFQ-QWJUGSESSA-N |
| XLogP | 6.60 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|