C31H22ClN3O6S3 — CID 118728685
(2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide (PubChem CID 118728685) has the molecular formula C31H22ClN3O6S3 and a molecular weight of 664.19 g/mol. Its IUPAC name is (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 118728685 |
| Molecular Formula | C31H22ClN3O6S3 |
| Molecular Weight | 664.19 g/mol |
| Exact Mass | 663.04 |
| IUPAC Name | (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)[C@H](Cc1ccccc1)N1C(=O)/C(=C/c2ccc(-c3ccccc3)cc2)SC1=S |
| InChI | InChI=1S/C31H22ClN3O6S3/c32-25-16-15-24(19-26(25)35(38)39)44(40,41)33-29(36)27(17-20-7-3-1-4-8-20)34-30(37)28(43-31(34)42)18-21-11-13-23(14-12-21)22-9-5-2-6-10-22/h1-16,18-19,27H,17H2,(H,33,36)/b28-18-/t27-/m0/s1 |
| InChIKey | SUZSSGSBCPFCBQ-ZNBSHBAVSA-N |
| XLogP | 6.23 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.19 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|