C33H24ClN3O8S3 — CID 118728689
methyl 4-[4-[(Z)-[3-[(2S)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]-1-oxo-3-phenylpropan-2-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzoate (PubChem CID 118728689) has the molecular formula C33H24ClN3O8S3 and a molecular weight of 722.22 g/mol. Its IUPAC name is methyl 4-[4-[(Z)-[3-[(2S)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]-1-oxo-3-phenylpropan-2-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzoate.
| Compound Name | methyl 4-[4-[(Z)-[3-[(2S)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]-1-oxo-3-phenylpropan-2-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 118728689 |
| Molecular Formula | C33H24ClN3O8S3 |
| Molecular Weight | 722.22 g/mol |
| Exact Mass | 721.04 |
| IUPAC Name | methyl 4-[4-[(Z)-[3-[(2S)-1-[(4-chloro-3-nitrophenyl)sulfonylamino]-1-oxo-3-phenylpropan-2-yl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/C=C3\SC(=S)N([C@@H](Cc4ccccc4)C(=O)NS(=O)(=O)c4ccc(Cl)c([N+](=O)[O-])c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C33H24ClN3O8S3/c1-45-32(40)24-13-11-23(12-14-24)22-9-7-21(8-10-22)18-29-31(39)36(33(46)47-29)28(17-20-5-3-2-4-6-20)30(38)35-48(43,44)25-15-16-26(34)27(19-25)37(41)42/h2-16,18-19,28H,17H2,1H3,(H,35,38)/b29-18-/t28-/m0/s1 |
| InChIKey | ZQZMIHSCFJTHMT-RBAUZFLXSA-N |
| XLogP | 6.02 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.22 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|