C31H21Cl2N3O6S3 — CID 118728686
(2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide (PubChem CID 118728686) has the molecular formula C31H21Cl2N3O6S3 and a molecular weight of 698.63 g/mol. Its IUPAC name is (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 118728686 |
| Molecular Formula | C31H21Cl2N3O6S3 |
| Molecular Weight | 698.63 g/mol |
| Exact Mass | 697.00 |
| IUPAC Name | (2S)-N-(4-chloro-3-nitrophenyl)sulfonyl-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)[C@H](Cc1ccccc1)N1C(=O)/C(=C/c2ccc(-c3ccc(Cl)cc3)cc2)SC1=S |
| InChI | InChI=1S/C31H21Cl2N3O6S3/c32-23-12-10-22(11-13-23)21-8-6-20(7-9-21)17-28-30(38)35(31(43)44-28)27(16-19-4-2-1-3-5-19)29(37)34-45(41,42)24-14-15-25(33)26(18-24)36(39)40/h1-15,17-18,27H,16H2,(H,34,37)/b28-17-/t27-/m0/s1 |
| InChIKey | XHKNIWAQOMDZOS-CGBWALKFSA-N |
| XLogP | 6.89 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|