About dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate
dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate (PubChem CID 118729111) has the molecular formula C24H24O5S2
and a molecular weight of 456.59 g/mol. Its IUPAC name is dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate.
Molecular Properties
| Compound Name | dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate |
| PubChem CID | 118729111 |
| Molecular Formula | C24H24O5S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate |
| SMILES | COc1ccc(C(=O)OCCCCC#Cc2ccc(C(=O)OC3CSSC3)cc2)cc1 |
| InChI | InChI=1S/C24H24O5S2/c1-27-21-13-11-19(12-14-21)23(25)28-15-5-3-2-4-6-18-7-9-20(10-8-18)24(26)29-22-16-30-31-17-22/h7-14,22H,2-3,5,15-17H2,1H3 |
| InChIKey | YHHDGRQPZAIHTE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate?
The IUPAC name of dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate (CID 118729111) is dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate.
What is the SMILES notation for dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate?
The canonical SMILES for dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate is COc1ccc(C(=O)OCCCCC#Cc2ccc(C(=O)OC3CSSC3)cc2)cc1.
What is the InChIKey of dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate?
The InChIKey is YHHDGRQPZAIHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O5S2/c1-27-21-13-11-19(12-14-21)23(25)28-15-5-3-2-4-6-18-7-9-20(10-8-18)24(26)29-22-16-30-31-17-22/h7-14,22H,2-3,5,15-17H2,1H3.
What are the key properties of dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate?
dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate has a molecular weight of 456.59 g/mol, XLogP of 4.99, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dithiolan-4-yl 4-[6-(4-methoxybenzoyl)oxyhex-1-ynyl]benzoate is sourced from PubChem (CID 118729111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).