C15H9F3O4S — CID 118729381
6-[4-(trifluoromethoxy)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide (PubChem CID 118729381) has the molecular formula C15H9F3O4S and a molecular weight of 342.29 g/mol. Its IUPAC name is 6-[4-(trifluoromethoxy)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide.
| Compound Name | 6-[4-(trifluoromethoxy)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide |
|---|---|
| PubChem CID | 118729381 |
| Molecular Formula | C15H9F3O4S |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 6-[4-(trifluoromethoxy)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide |
| SMILES | O=S1(=O)C=Cc2cc(-c3ccc(OC(F)(F)F)cc3)ccc2O1 |
| InChI | InChI=1S/C15H9F3O4S/c16-15(17,18)21-13-4-1-10(2-5-13)11-3-6-14-12(9-11)7-8-23(19,20)22-14/h1-9H |
| InChIKey | YXRGHVLDANHSPK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|