C23H26N4S — CID 118729686
1-(4-methylphenyl)-3-[1-(2-methylquinolin-4-yl)piperidin-4-yl]thiourea (PubChem CID 118729686) has the molecular formula C23H26N4S and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[1-(2-methylquinolin-4-yl)piperidin-4-yl]thiourea.
| Compound Name | 1-(4-methylphenyl)-3-[1-(2-methylquinolin-4-yl)piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 118729686 |
| Molecular Formula | C23H26N4S |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-(4-methylphenyl)-3-[1-(2-methylquinolin-4-yl)piperidin-4-yl]thiourea |
| SMILES | Cc1ccc(NC(=S)NC2CCN(c3cc(C)nc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C23H26N4S/c1-16-7-9-18(10-8-16)25-23(28)26-19-11-13-27(14-12-19)22-15-17(2)24-21-6-4-3-5-20(21)22/h3-10,15,19H,11-14H2,1-2H3,(H2,25,26,28) |
| InChIKey | NQUTUNDHQKVIDJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|