C22H23ClN4OS — CID 25030083
1-[1-(6-chloroquinolin-4-yl)piperidin-4-yl]-3-(4-methoxyphenyl)thiourea (PubChem CID 25030083) has the molecular formula C22H23ClN4OS and a molecular weight of 426.97 g/mol. Its IUPAC name is 1-[1-(6-chloroquinolin-4-yl)piperidin-4-yl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[1-(6-chloroquinolin-4-yl)piperidin-4-yl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 25030083 |
| Molecular Formula | C22H23ClN4OS |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[1-(6-chloroquinolin-4-yl)piperidin-4-yl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NC2CCN(c3ccnc4ccc(Cl)cc34)CC2)cc1 |
| InChI | InChI=1S/C22H23ClN4OS/c1-28-18-5-3-16(4-6-18)25-22(29)26-17-9-12-27(13-10-17)21-8-11-24-20-7-2-15(23)14-19(20)21/h2-8,11,14,17H,9-10,12-13H2,1H3,(H2,25,26,29) |
| InChIKey | FCTRBKGADCXUEO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|