C23H25ClN4OS — CID 87726977
1-[1-(8-chloroquinolin-4-yl)piperidin-4-yl]-3-(3-ethoxyphenyl)thiourea (PubChem CID 87726977) has the molecular formula C23H25ClN4OS and a molecular weight of 441.00 g/mol. Its IUPAC name is 1-[1-(8-chloroquinolin-4-yl)piperidin-4-yl]-3-(3-ethoxyphenyl)thiourea.
| Compound Name | 1-[1-(8-chloroquinolin-4-yl)piperidin-4-yl]-3-(3-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 87726977 |
| Molecular Formula | C23H25ClN4OS |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-[1-(8-chloroquinolin-4-yl)piperidin-4-yl]-3-(3-ethoxyphenyl)thiourea |
| SMILES | CCOc1cccc(NC(=S)NC2CCN(c3ccnc4c(Cl)cccc34)CC2)c1 |
| InChI | InChI=1S/C23H25ClN4OS/c1-2-29-18-6-3-5-17(15-18)27-23(30)26-16-10-13-28(14-11-16)21-9-12-25-22-19(21)7-4-8-20(22)24/h3-9,12,15-16H,2,10-11,13-14H2,1H3,(H2,26,27,30) |
| InChIKey | NYJKITKHGNAHGC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|