C22H27ClN4O2 — CID 118730662
1-[3-chloro-5-(4-morpholin-4-ylphenyl)-4-pyridinyl]-4-methylpiperidine-4-carboxamide (PubChem CID 118730662) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-[3-chloro-5-(4-morpholin-4-ylphenyl)-4-pyridinyl]-4-methylpiperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-(4-morpholin-4-ylphenyl)-4-pyridinyl]-4-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 118730662 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[3-chloro-5-(4-morpholin-4-ylphenyl)-4-pyridinyl]-4-methylpiperidine-4-carboxamide |
| SMILES | CC1(C(N)=O)CCN(c2c(Cl)cncc2-c2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C22H27ClN4O2/c1-22(21(24)28)6-8-27(9-7-22)20-18(14-25-15-19(20)23)16-2-4-17(5-3-16)26-10-12-29-13-11-26/h2-5,14-15H,6-13H2,1H3,(H2,24,28) |
| InChIKey | KOTJOCOIHQWMHI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |