C17H17ClFN3O — CID 45275571
1-[3-chloro-5-(4-fluorophenyl)-4-pyridinyl]piperidine-4-carboxamide (PubChem CID 45275571) has the molecular formula C17H17ClFN3O and a molecular weight of 333.79 g/mol. Its IUPAC name is 1-[3-chloro-5-(4-fluorophenyl)-4-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-(4-fluorophenyl)-4-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45275571 |
| Molecular Formula | C17H17ClFN3O |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[3-chloro-5-(4-fluorophenyl)-4-pyridinyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2c(Cl)cncc2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H17ClFN3O/c18-15-10-21-9-14(11-1-3-13(19)4-2-11)16(15)22-7-5-12(6-8-22)17(20)23/h1-4,9-10,12H,5-8H2,(H2,20,23) |
| InChIKey | SERAWXAJXSKWSJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |