C16H16ClN3O — CID 45275778
(3S)-1-(3-chloro-5-phenyl-4-pyridinyl)pyrrolidine-3-carboxamide (PubChem CID 45275778) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is (3S)-1-(3-chloro-5-phenyl-4-pyridinyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(3-chloro-5-phenyl-4-pyridinyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 45275778 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (3S)-1-(3-chloro-5-phenyl-4-pyridinyl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCN(c2c(Cl)cncc2-c2ccccc2)C1 |
| InChI | InChI=1S/C16H16ClN3O/c17-14-9-19-8-13(11-4-2-1-3-5-11)15(14)20-7-6-12(10-20)16(18)21/h1-5,8-9,12H,6-7,10H2,(H2,18,21)/t12-/m0/s1 |
| InChIKey | RCEVRUVGBLYHEY-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |