C16H19Cl2N3O — CID 175830062
1-(4-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 175830062) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is 1-(4-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | 1-(4-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 175830062 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(4-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)C1CCN(c2ccc(-c3cccnc3)cc2)C1 |
| InChI | InChI=1S/C16H17N3O.2ClH/c17-16(20)14-7-9-19(11-14)15-5-3-12(4-6-15)13-2-1-8-18-10-13;;/h1-6,8,10,14H,7,9,11H2,(H2,17,20);2*1H |
| InChIKey | RCIBTIILEDIQOI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |