C10H15Cl2N3O — CID 175830226
1-pyridin-3-ylpyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 175830226) has the molecular formula C10H15Cl2N3O and a molecular weight of 264.16 g/mol. Its IUPAC name is 1-pyridin-3-ylpyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | 1-pyridin-3-ylpyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 175830226 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-pyridin-3-ylpyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)C1CCN(c2cccnc2)C1 |
| InChI | InChI=1S/C10H13N3O.2ClH/c11-10(14)8-3-5-13(7-8)9-2-1-4-12-6-9;;/h1-2,4,6,8H,3,5,7H2,(H2,11,14);2*1H |
| InChIKey | XCQUPVWCUNCOKI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |