C34H35FN6O5 — CID 118731179
(E)-3-[5-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-3-ethoxypyrazin-2-yl]prop-2-enoic acid (PubChem CID 118731179) has the molecular formula C34H35FN6O5 and a molecular weight of 626.69 g/mol. Its IUPAC name is (E)-3-[5-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-3-ethoxypyrazin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-3-ethoxypyrazin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118731179 |
| Molecular Formula | C34H35FN6O5 |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | (E)-3-[5-[[1-[[3-cyclopentyl-2-(5-fluoro-2-pyridinyl)-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-3-ethoxypyrazin-2-yl]prop-2-enoic acid |
| SMILES | CCOc1nc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccc(F)cn5)n(C)c4c3)CCC2)cnc1/C=C/C(=O)O |
| InChI | InChI=1S/C34H35FN6O5/c1-3-46-32-25(13-14-28(42)43)37-19-27(38-32)39-33(45)34(15-6-16-34)40-31(44)21-9-11-23-26(17-21)41(2)30(24-12-10-22(35)18-36-24)29(23)20-7-4-5-8-20/h9-14,17-20H,3-8,15-16H2,1-2H3,(H,40,44)(H,42,43)(H,38,39,45)/b14-13+ |
| InChIKey | GPWQFZRBAOMGBC-BUHFOSPRSA-N |
| XLogP | 5.61 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|