C23H18N2O4 — CID 118732928
4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzamide (PubChem CID 118732928) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzamide.
| Compound Name | 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 118732928 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(Cc3ccc4c(c3)CC(=O)N(O)C4=O)cc2)cc1 |
| InChI | InChI=1S/C23H18N2O4/c24-22(27)18-8-6-17(7-9-18)16-4-1-14(2-5-16)11-15-3-10-20-19(12-15)13-21(26)25(29)23(20)28/h1-10,12,29H,11,13H2,(H2,24,27) |
| InChIKey | ZQLRXYMHSMKQGV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|