C24H15F6NO3 — CID 118732930
6-[[4-[2,4-bis(trifluoromethyl)phenyl]phenyl]methyl]-2-hydroxy-4H-isoquinoline-1,3-dione (PubChem CID 118732930) has the molecular formula C24H15F6NO3 and a molecular weight of 479.38 g/mol. Its IUPAC name is 6-[[4-[2,4-bis(trifluoromethyl)phenyl]phenyl]methyl]-2-hydroxy-4H-isoquinoline-1,3-dione.
| Compound Name | 6-[[4-[2,4-bis(trifluoromethyl)phenyl]phenyl]methyl]-2-hydroxy-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 118732930 |
| Molecular Formula | C24H15F6NO3 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 6-[[4-[2,4-bis(trifluoromethyl)phenyl]phenyl]methyl]-2-hydroxy-4H-isoquinoline-1,3-dione |
| SMILES | O=C1Cc2cc(Cc3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)cc3)ccc2C(=O)N1O |
| InChI | InChI=1S/C24H15F6NO3/c25-23(26,27)17-6-8-18(20(12-17)24(28,29)30)15-4-1-13(2-5-15)9-14-3-7-19-16(10-14)11-21(32)31(34)22(19)33/h1-8,10,12,34H,9,11H2 |
| InChIKey | DQGUXVBONUSNHE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|