C21H18N4O3S2 — CID 118733019
methyl 4-[5-(1,3-benzothiazol-2-ylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate (PubChem CID 118733019) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is methyl 4-[5-(1,3-benzothiazol-2-ylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate.
| Compound Name | methyl 4-[5-(1,3-benzothiazol-2-ylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 118733019 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | methyl 4-[5-(1,3-benzothiazol-2-ylcarbamoyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2NC(=S)NC(C)=C2C(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H18N4O3S2/c1-11-16(18(26)25-21-23-14-5-3-4-6-15(14)30-21)17(24-20(29)22-11)12-7-9-13(10-8-12)19(27)28-2/h3-10,17H,1-2H3,(H2,22,24,29)(H,23,25,26) |
| InChIKey | MKKRGNXAARTQLV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|