C30H47NO4 — CID 118734249
4-[2-hydroxy-3-[[(E)-octadec-9-enyl]amino]propoxy]chromen-2-one (PubChem CID 118734249) has the molecular formula C30H47NO4 and a molecular weight of 485.71 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[[(E)-octadec-9-enyl]amino]propoxy]chromen-2-one.
| Compound Name | 4-[2-hydroxy-3-[[(E)-octadec-9-enyl]amino]propoxy]chromen-2-one |
|---|---|
| PubChem CID | 118734249 |
| Molecular Formula | C30H47NO4 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.35 |
| IUPAC Name | 4-[2-hydroxy-3-[[(E)-octadec-9-enyl]amino]propoxy]chromen-2-one |
| SMILES | CCCCCCCC/C=C/CCCCCCCCNCC(O)COc1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C30H47NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22-31-24-26(32)25-34-29-23-30(33)35-28-21-18-17-20-27(28)29/h9-10,17-18,20-21,23,26,31-32H,2-8,11-16,19,22,24-25H2,1H3/b10-9+ |
| InChIKey | VPBBSELCFCVNNT-MDZDMXLPSA-N |
| XLogP | 7.16 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|