C21H20N2O3 — CID 118734930
2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-butylquinazolin-4-one (PubChem CID 118734930) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-butylquinazolin-4-one.
| Compound Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-butylquinazolin-4-one |
|---|---|
| PubChem CID | 118734930 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-butylquinazolin-4-one |
| SMILES | CCCCn1c(/C=C/c2ccc3c(c2)OCO3)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H20N2O3/c1-2-3-12-23-20(22-17-7-5-4-6-16(17)21(23)24)11-9-15-8-10-18-19(13-15)26-14-25-18/h4-11,13H,2-3,12,14H2,1H3/b11-9+ |
| InChIKey | PQNUJKWUVAIZDQ-PKNBQFBNSA-N |
| XLogP | 4.10 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |