C36H26Cl4N4O2 — CID 138858437
2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-3-[4-[2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-4-oxoquinazolin-3-yl]butyl]quinazolin-4-one (PubChem CID 138858437) has the molecular formula C36H26Cl4N4O2 and a molecular weight of 688.44 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-3-[4-[2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-4-oxoquinazolin-3-yl]butyl]quinazolin-4-one.
| Compound Name | 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-3-[4-[2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-4-oxoquinazolin-3-yl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 138858437 |
| Molecular Formula | C36H26Cl4N4O2 |
| Molecular Weight | 688.44 g/mol |
| Exact Mass | 686.08 |
| IUPAC Name | 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-3-[4-[2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-4-oxoquinazolin-3-yl]butyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(/C=C/c2ccc(Cl)cc2Cl)n1CCCCn1c(/C=C/c2ccc(Cl)cc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C36H26Cl4N4O2/c37-25-15-11-23(29(39)21-25)13-17-33-41-31-9-3-1-7-27(31)35(45)43(33)19-5-6-20-44-34(18-14-24-12-16-26(38)22-30(24)40)42-32-10-4-2-8-28(32)36(44)46/h1-4,7-18,21-22H,5-6,19-20H2/b17-13+,18-14+ |
| InChIKey | UMOATXPQYPVEAQ-HBKJEHTGSA-N |
| XLogP | 9.54 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.44 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|