C22H14N2S2 — CID 118735947
5-(1-benzothiophen-3-yl)-4-(5-phenylthiophen-2-yl)pyrimidine (PubChem CID 118735947) has the molecular formula C22H14N2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 5-(1-benzothiophen-3-yl)-4-(5-phenylthiophen-2-yl)pyrimidine.
| Compound Name | 5-(1-benzothiophen-3-yl)-4-(5-phenylthiophen-2-yl)pyrimidine |
|---|---|
| PubChem CID | 118735947 |
| Molecular Formula | C22H14N2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 5-(1-benzothiophen-3-yl)-4-(5-phenylthiophen-2-yl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3ncncc3-c3csc4ccccc34)s2)cc1 |
| InChI | InChI=1S/C22H14N2S2/c1-2-6-15(7-3-1)19-10-11-21(26-19)22-17(12-23-14-24-22)18-13-25-20-9-5-4-8-16(18)20/h1-14H |
| InChIKey | ODZNJEYARXRPMH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |