C23H17ClF3N3 — CID 118736307
4-chloro-N-[[1-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]aniline (PubChem CID 118736307) has the molecular formula C23H17ClF3N3 and a molecular weight of 427.86 g/mol. Its IUPAC name is 4-chloro-N-[[1-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]aniline.
| Compound Name | 4-chloro-N-[[1-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 118736307 |
| Molecular Formula | C23H17ClF3N3 |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-chloro-N-[[1-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]methyl]aniline |
| SMILES | FC(F)(F)c1ccc(-c2nn(-c3ccccc3)cc2CNc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H17ClF3N3/c24-19-10-12-20(13-11-19)28-14-17-15-30(21-4-2-1-3-5-21)29-22(17)16-6-8-18(9-7-16)23(25,26)27/h1-13,15,28H,14H2 |
| InChIKey | OZLVTOMCLJZXFW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |