C16H20N2O3S — CID 118736325
4-[2-[(2-hydroxy-3-methylphenyl)methylamino]ethyl]benzenesulfonamide (PubChem CID 118736325) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-[2-[(2-hydroxy-3-methylphenyl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(2-hydroxy-3-methylphenyl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118736325 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-[2-[(2-hydroxy-3-methylphenyl)methylamino]ethyl]benzenesulfonamide |
| SMILES | Cc1cccc(CNCCc2ccc(S(N)(=O)=O)cc2)c1O |
| InChI | InChI=1S/C16H20N2O3S/c1-12-3-2-4-14(16(12)19)11-18-10-9-13-5-7-15(8-6-13)22(17,20)21/h2-8,18-19H,9-11H2,1H3,(H2,17,20,21) |
| InChIKey | PYZCQFCIGHPJDG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|