C15H17BrN2O3S — CID 118736326
4-[2-[(5-bromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide (PubChem CID 118736326) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is 4-[2-[(5-bromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(5-bromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118736326 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 4-[2-[(5-bromo-2-hydroxyphenyl)methylamino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNCc2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C15H17BrN2O3S/c16-13-3-6-15(19)12(9-13)10-18-8-7-11-1-4-14(5-2-11)22(17,20)21/h1-6,9,18-19H,7-8,10H2,(H2,17,20,21) |
| InChIKey | LPMYKPCLEYMBGJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|