C18H21BrN2O3S — CID 1151381
4-bromo-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]phenol (PubChem CID 1151381) has the molecular formula C18H21BrN2O3S and a molecular weight of 425.35 g/mol. Its IUPAC name is 4-bromo-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]phenol.
| Compound Name | 4-bromo-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 1151381 |
| Molecular Formula | C18H21BrN2O3S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-bromo-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]phenol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(Cc3cc(Br)ccc3O)CC2)cc1 |
| InChI | InChI=1S/C18H21BrN2O3S/c1-14-2-5-17(6-3-14)25(23,24)21-10-8-20(9-11-21)13-15-12-16(19)4-7-18(15)22/h2-7,12,22H,8-11,13H2,1H3 |
| InChIKey | PYWGZLXKQWKHQP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|