C17H11ClN4S — CID 118736891
N-(4-chlorophenyl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine (PubChem CID 118736891) has the molecular formula C17H11ClN4S and a molecular weight of 338.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine.
| Compound Name | N-(4-chlorophenyl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 118736891 |
| Molecular Formula | C17H11ClN4S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-(4-chlorophenyl)-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
| SMILES | Clc1ccc(Nc2ncnc3ccc(-c4cncs4)cc23)cc1 |
| InChI | InChI=1S/C17H11ClN4S/c18-12-2-4-13(5-3-12)22-17-14-7-11(16-8-19-10-23-16)1-6-15(14)20-9-21-17/h1-10H,(H,20,21,22) |
| InChIKey | NMBAKNSXUASOOK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |