C16H11N5S — CID 118736909
N-pyridin-3-yl-6-(1,3-thiazol-5-yl)quinazolin-4-amine (PubChem CID 118736909) has the molecular formula C16H11N5S and a molecular weight of 305.37 g/mol. Its IUPAC name is N-pyridin-3-yl-6-(1,3-thiazol-5-yl)quinazolin-4-amine.
| Compound Name | N-pyridin-3-yl-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 118736909 |
| Molecular Formula | C16H11N5S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-pyridin-3-yl-6-(1,3-thiazol-5-yl)quinazolin-4-amine |
| SMILES | c1cncc(Nc2ncnc3ccc(-c4cncs4)cc23)c1 |
| InChI | InChI=1S/C16H11N5S/c1-2-12(7-17-5-1)21-16-13-6-11(15-8-18-10-22-15)3-4-14(13)19-9-20-16/h1-10H,(H,19,20,21) |
| InChIKey | GZYBMNSSZHWNFF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |